C19H23ClN2O2 — CID 134324080
5-[(4-chloro-6H-isochromeno[3,4-c]pyridin-8-yl)oxy]-2,4-dimethylpentan-2-amine (PubChem CID 134324080) has the molecular formula C19H23ClN2O2 and a molecular weight of 346.86 g/mol. Its IUPAC name is 5-[(4-chloro-6H-isochromeno[3,4-c]pyridin-8-yl)oxy]-2,4-dimethylpentan-2-amine.
| Compound Name | 5-[(4-chloro-6H-isochromeno[3,4-c]pyridin-8-yl)oxy]-2,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 134324080 |
| Molecular Formula | C19H23ClN2O2 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 5-[(4-chloro-6H-isochromeno[3,4-c]pyridin-8-yl)oxy]-2,4-dimethylpentan-2-amine |
| SMILES | CC(COc1ccc2c(c1)COc1c-2ccnc1Cl)CC(C)(C)N |
| InChI | InChI=1S/C19H23ClN2O2/c1-12(9-19(2,3)21)10-23-14-4-5-15-13(8-14)11-24-17-16(15)6-7-22-18(17)20/h4-8,12H,9-11,21H2,1-3H3 |
| InChIKey | BECRIPAHHUCRHR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|