C19H23N3O2 — CID 138650831
8-[2-methyl-4-(methylideneamino)pentoxy]-6H-isochromeno[3,4-c]pyridin-4-amine (PubChem CID 138650831) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 8-[2-methyl-4-(methylideneamino)pentoxy]-6H-isochromeno[3,4-c]pyridin-4-amine.
| Compound Name | 8-[2-methyl-4-(methylideneamino)pentoxy]-6H-isochromeno[3,4-c]pyridin-4-amine |
|---|---|
| PubChem CID | 138650831 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 8-[2-methyl-4-(methylideneamino)pentoxy]-6H-isochromeno[3,4-c]pyridin-4-amine |
| SMILES | C=NC(C)CC(C)COc1ccc2c(c1)COc1c-2ccnc1N |
| InChI | InChI=1S/C19H23N3O2/c1-12(8-13(2)21-3)10-23-15-4-5-16-14(9-15)11-24-18-17(16)6-7-22-19(18)20/h4-7,9,12-13H,3,8,10-11H2,1-2H3,(H2,20,22) |
| InChIKey | AMMNHEULDBOXSB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|