C14H23N3NaO3S2 — CID 134328577
CID 134328577 (PubChem CID 134328577) has the molecular formula C14H23N3NaO3S2 and a molecular weight of 368.48 g/mol.
| Compound Name | CID 134328577 |
|---|---|
| PubChem CID | 134328577 |
| Molecular Formula | C14H23N3NaO3S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | — |
| SMILES | O=C(CCCCC(S)CCS)N[C@@H](Cc1cnc[nH]1)C(=O)O.[Na] |
| InChI | InChI=1S/C14H23N3O3S2.Na/c18-13(4-2-1-3-11(22)5-6-21)17-12(14(19)20)7-10-8-15-9-16-10;/h8-9,11-12,21-22H,1-7H2,(H,15,16)(H,17,18)(H,19,20);/t11?,12-;/m0./s1 |
| InChIKey | YLVKEHFFJLUJHX-MMFRDWCLSA-N |
| XLogP | 1.32 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|