About (4-chlorophenyl)methyl carbamate
(4-chlorophenyl)methyl carbamate (PubChem CID 13433129) has the molecular formula C8H8ClNO2
and a molecular weight of 185.61 g/mol. Its IUPAC name is (4-chlorophenyl)methyl carbamate.
Molecular Properties
| Compound Name | (4-chlorophenyl)methyl carbamate |
| PubChem CID | 13433129 |
| Molecular Formula | C8H8ClNO2 |
| Molecular Weight | 185.61 g/mol |
| Exact Mass | 185.02 |
| IUPAC Name | (4-chlorophenyl)methyl carbamate |
| SMILES | NC(=O)OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H8ClNO2/c9-7-3-1-6(2-4-7)5-12-8(10)11/h1-4H,5H2,(H2,10,11) |
| InChIKey | HIIOEWGKFCWTJU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.61 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-chlorophenyl)methyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)methyl carbamate?
The IUPAC name of (4-chlorophenyl)methyl carbamate (CID 13433129) is (4-chlorophenyl)methyl carbamate.
What is the SMILES notation for (4-chlorophenyl)methyl carbamate?
The canonical SMILES for (4-chlorophenyl)methyl carbamate is NC(=O)OCc1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl)methyl carbamate?
The InChIKey is HIIOEWGKFCWTJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNO2/c9-7-3-1-6(2-4-7)5-12-8(10)11/h1-4H,5H2,(H2,10,11).
What are the key properties of (4-chlorophenyl)methyl carbamate?
(4-chlorophenyl)methyl carbamate has a molecular weight of 185.61 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)methyl carbamate is sourced from PubChem (CID 13433129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).