C12H23N — CID 134338397
(1E)-2-tert-butyl-3-ethyl-N-methylpenta-1,4-dien-1-amine (PubChem CID 134338397) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (1E)-2-tert-butyl-3-ethyl-N-methylpenta-1,4-dien-1-amine.
| Compound Name | (1E)-2-tert-butyl-3-ethyl-N-methylpenta-1,4-dien-1-amine |
|---|---|
| PubChem CID | 134338397 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (1E)-2-tert-butyl-3-ethyl-N-methylpenta-1,4-dien-1-amine |
| SMILES | C=CC(CC)/C(=C\NC)C(C)(C)C |
| InChI | InChI=1S/C12H23N/c1-7-10(8-2)11(9-13-6)12(3,4)5/h7,9-10,13H,1,8H2,2-6H3/b11-9+ |
| InChIKey | KRSUDMDFFPEKIO-PKNBQFBNSA-N |
| XLogP | 3.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|