C17H34FN5 — CID 134340085
5-fluoro-1-methyl-4-[4-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]piperidin-3-amine (PubChem CID 134340085) has the molecular formula C17H34FN5 and a molecular weight of 327.49 g/mol. Its IUPAC name is 5-fluoro-1-methyl-4-[4-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]piperidin-3-amine.
| Compound Name | 5-fluoro-1-methyl-4-[4-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 134340085 |
| Molecular Formula | C17H34FN5 |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.28 |
| IUPAC Name | 5-fluoro-1-methyl-4-[4-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]piperidin-3-amine |
| SMILES | CN1CCN(CC2CCN(C3C(N)CN(C)CC3F)CC2)CC1 |
| InChI | InChI=1S/C17H34FN5/c1-20-7-9-22(10-8-20)11-14-3-5-23(6-4-14)17-15(18)12-21(2)13-16(17)19/h14-17H,3-13,19H2,1-2H3 |
| InChIKey | NDTGFISSKFWQMK-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 38.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |