C18H34FN3 — CID 167091285
4-fluoro-1-(1-methylpiperidin-4-yl)-4-[(4-methylpiperidin-1-yl)methyl]piperidine (PubChem CID 167091285) has the molecular formula C18H34FN3 and a molecular weight of 311.49 g/mol. Its IUPAC name is 4-fluoro-1-(1-methylpiperidin-4-yl)-4-[(4-methylpiperidin-1-yl)methyl]piperidine.
| Compound Name | 4-fluoro-1-(1-methylpiperidin-4-yl)-4-[(4-methylpiperidin-1-yl)methyl]piperidine |
|---|---|
| PubChem CID | 167091285 |
| Molecular Formula | C18H34FN3 |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 311.27 |
| IUPAC Name | 4-fluoro-1-(1-methylpiperidin-4-yl)-4-[(4-methylpiperidin-1-yl)methyl]piperidine |
| SMILES | CC1CCN(CC2(F)CCN(C3CCN(C)CC3)CC2)CC1 |
| InChI | InChI=1S/C18H34FN3/c1-16-3-11-21(12-4-16)15-18(19)7-13-22(14-8-18)17-5-9-20(2)10-6-17/h16-17H,3-15H2,1-2H3 |
| InChIKey | XCOTYGPDMVMFSK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |