C20H25BrN4O2 — CID 134340485
tert-butyl 4-[(2-bromo-7-cyano-6-methylindolizin-5-yl)amino]piperidine-1-carboxylate (PubChem CID 134340485) has the molecular formula C20H25BrN4O2 and a molecular weight of 433.35 g/mol. Its IUPAC name is tert-butyl 4-[(2-bromo-7-cyano-6-methylindolizin-5-yl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-bromo-7-cyano-6-methylindolizin-5-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 134340485 |
| Molecular Formula | C20H25BrN4O2 |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | tert-butyl 4-[(2-bromo-7-cyano-6-methylindolizin-5-yl)amino]piperidine-1-carboxylate |
| SMILES | Cc1c(C#N)cc2cc(Br)cn2c1NC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H25BrN4O2/c1-13-14(11-22)9-17-10-15(21)12-25(17)18(13)23-16-5-7-24(8-6-16)19(26)27-20(2,3)4/h9-10,12,16,23H,5-8H2,1-4H3 |
| InChIKey | YMIRMKNNWHOHTG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 69.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |