C20H27BrN4O2 — CID 175337047
tert-butyl 4-[(2-bromo-7-cyano-6-methyl-2,3-dihydro-1H-indol-5-yl)amino]piperidine-1-carboxylate (PubChem CID 175337047) has the molecular formula C20H27BrN4O2 and a molecular weight of 435.37 g/mol. Its IUPAC name is tert-butyl 4-[(2-bromo-7-cyano-6-methyl-2,3-dihydro-1H-indol-5-yl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-bromo-7-cyano-6-methyl-2,3-dihydro-1H-indol-5-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175337047 |
| Molecular Formula | C20H27BrN4O2 |
| Molecular Weight | 435.37 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | tert-butyl 4-[(2-bromo-7-cyano-6-methyl-2,3-dihydro-1H-indol-5-yl)amino]piperidine-1-carboxylate |
| SMILES | Cc1c(NC2CCN(C(=O)OC(C)(C)C)CC2)cc2c(c1C#N)NC(Br)C2 |
| InChI | InChI=1S/C20H27BrN4O2/c1-12-15(11-22)18-13(10-17(21)24-18)9-16(12)23-14-5-7-25(8-6-14)19(26)27-20(2,3)4/h9,14,17,23-24H,5-8,10H2,1-4H3 |
| InChIKey | ZPPMSCYWNWYDGK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|