C7H13O6P — CID 134344558
ethyl 2-hydroxy-5,5-dimethyl-2-oxo-1,4,2λ5-dioxaphospholane-3-carboxylate (PubChem CID 134344558) has the molecular formula C7H13O6P and a molecular weight of 224.15 g/mol. Its IUPAC name is ethyl 2-hydroxy-5,5-dimethyl-2-oxo-1,4,2λ5-dioxaphospholane-3-carboxylate.
| Compound Name | ethyl 2-hydroxy-5,5-dimethyl-2-oxo-1,4,2λ5-dioxaphospholane-3-carboxylate |
|---|---|
| PubChem CID | 134344558 |
| Molecular Formula | C7H13O6P |
| Molecular Weight | 224.15 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | ethyl 2-hydroxy-5,5-dimethyl-2-oxo-1,4,2λ5-dioxaphospholane-3-carboxylate |
| SMILES | CCOC(=O)C1OC(C)(C)OP1(=O)O |
| InChI | InChI=1S/C7H13O6P/c1-4-11-5(8)6-12-7(2,3)13-14(6,9)10/h6H,4H2,1-3H3,(H,9,10) |
| InChIKey | ZENGSFYGNGPVKM-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.15 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|