C25H27ClN4O2S — CID 134345729
1-[6-[[5-chloro-6-(2-methylphenyl)-2-pyridinyl]amino]sulfanyl-2-pyridinyl]-3-ethylpiperidine-3-carboxylic acid (PubChem CID 134345729) has the molecular formula C25H27ClN4O2S and a molecular weight of 483.04 g/mol. Its IUPAC name is 1-[6-[[5-chloro-6-(2-methylphenyl)-2-pyridinyl]amino]sulfanyl-2-pyridinyl]-3-ethylpiperidine-3-carboxylic acid.
| Compound Name | 1-[6-[[5-chloro-6-(2-methylphenyl)-2-pyridinyl]amino]sulfanyl-2-pyridinyl]-3-ethylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 134345729 |
| Molecular Formula | C25H27ClN4O2S |
| Molecular Weight | 483.04 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 1-[6-[[5-chloro-6-(2-methylphenyl)-2-pyridinyl]amino]sulfanyl-2-pyridinyl]-3-ethylpiperidine-3-carboxylic acid |
| SMILES | CCC1(C(=O)O)CCCN(c2cccc(SNc3ccc(Cl)c(-c4ccccc4C)n3)n2)C1 |
| InChI | InChI=1S/C25H27ClN4O2S/c1-3-25(24(31)32)14-7-15-30(16-25)21-10-6-11-22(28-21)33-29-20-13-12-19(26)23(27-20)18-9-5-4-8-17(18)2/h4-6,8-13H,3,7,14-16H2,1-2H3,(H,27,29)(H,31,32) |
| InChIKey | BWYPSNLBRWAUAO-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.04 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|