C26H29ClN4O2S — CID 166716923
1-[6-[[5-chloro-6-(2-propan-2-ylphenyl)-2-pyridinyl]amino]sulfanyl-2-pyridinyl]-3-methylpiperidine-3-carboxylic acid (PubChem CID 166716923) has the molecular formula C26H29ClN4O2S and a molecular weight of 497.06 g/mol. Its IUPAC name is 1-[6-[[5-chloro-6-(2-propan-2-ylphenyl)-2-pyridinyl]amino]sulfanyl-2-pyridinyl]-3-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[6-[[5-chloro-6-(2-propan-2-ylphenyl)-2-pyridinyl]amino]sulfanyl-2-pyridinyl]-3-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 166716923 |
| Molecular Formula | C26H29ClN4O2S |
| Molecular Weight | 497.06 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 1-[6-[[5-chloro-6-(2-propan-2-ylphenyl)-2-pyridinyl]amino]sulfanyl-2-pyridinyl]-3-methylpiperidine-3-carboxylic acid |
| SMILES | CC(C)c1ccccc1-c1nc(NSc2cccc(N3CCCC(C)(C(=O)O)C3)n2)ccc1Cl |
| InChI | InChI=1S/C26H29ClN4O2S/c1-17(2)18-8-4-5-9-19(18)24-20(27)12-13-21(28-24)30-34-23-11-6-10-22(29-23)31-15-7-14-26(3,16-31)25(32)33/h4-6,8-13,17H,7,14-16H2,1-3H3,(H,28,30)(H,32,33) |
| InChIKey | XDWRDLPPNZCISX-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.06 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|