C28H31F3N4O2S — CID 166716803
1-[6-[[6-(2-ethylphenyl)-5-(trifluoromethyl)-2-pyridinyl]amino]sulfanyl-2-pyridinyl]-3-propylpiperidine-3-carboxylic acid (PubChem CID 166716803) has the molecular formula C28H31F3N4O2S and a molecular weight of 544.64 g/mol. Its IUPAC name is 1-[6-[[6-(2-ethylphenyl)-5-(trifluoromethyl)-2-pyridinyl]amino]sulfanyl-2-pyridinyl]-3-propylpiperidine-3-carboxylic acid.
| Compound Name | 1-[6-[[6-(2-ethylphenyl)-5-(trifluoromethyl)-2-pyridinyl]amino]sulfanyl-2-pyridinyl]-3-propylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 166716803 |
| Molecular Formula | C28H31F3N4O2S |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | 1-[6-[[6-(2-ethylphenyl)-5-(trifluoromethyl)-2-pyridinyl]amino]sulfanyl-2-pyridinyl]-3-propylpiperidine-3-carboxylic acid |
| SMILES | CCCC1(C(=O)O)CCCN(c2cccc(SNc3ccc(C(F)(F)F)c(-c4ccccc4CC)n3)n2)C1 |
| InChI | InChI=1S/C28H31F3N4O2S/c1-3-15-27(26(36)37)16-8-17-35(18-27)23-11-7-12-24(33-23)38-34-22-14-13-21(28(29,30)31)25(32-22)20-10-6-5-9-19(20)4-2/h5-7,9-14H,3-4,8,15-18H2,1-2H3,(H,32,34)(H,36,37) |
| InChIKey | UHYCNHUYVVRQGE-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|