C27H27F3N4OS — CID 166716625
1-[6-[[6-(2-cyclopropylphenyl)-5-(trifluoromethyl)-2-pyridinyl]amino]sulfanyl-2-pyridinyl]-4-methylpiperidine-4-carbaldehyde (PubChem CID 166716625) has the molecular formula C27H27F3N4OS and a molecular weight of 512.60 g/mol. Its IUPAC name is 1-[6-[[6-(2-cyclopropylphenyl)-5-(trifluoromethyl)-2-pyridinyl]amino]sulfanyl-2-pyridinyl]-4-methylpiperidine-4-carbaldehyde.
| Compound Name | 1-[6-[[6-(2-cyclopropylphenyl)-5-(trifluoromethyl)-2-pyridinyl]amino]sulfanyl-2-pyridinyl]-4-methylpiperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 166716625 |
| Molecular Formula | C27H27F3N4OS |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 1-[6-[[6-(2-cyclopropylphenyl)-5-(trifluoromethyl)-2-pyridinyl]amino]sulfanyl-2-pyridinyl]-4-methylpiperidine-4-carbaldehyde |
| SMILES | CC1(C=O)CCN(c2cccc(SNc3ccc(C(F)(F)F)c(-c4ccccc4C4CC4)n3)n2)CC1 |
| InChI | InChI=1S/C27H27F3N4OS/c1-26(17-35)13-15-34(16-14-26)23-7-4-8-24(32-23)36-33-22-12-11-21(27(28,29)30)25(31-22)20-6-3-2-5-19(20)18-9-10-18/h2-8,11-12,17-18H,9-10,13-16H2,1H3,(H,31,33) |
| InChIKey | VRFPHEQGZKGMJH-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|