C26H27F3N4S — CID 166716770
6-(2-cyclopropylphenyl)-N-[[6-(3-methylpiperidin-1-yl)-2-pyridinyl]sulfanyl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 166716770) has the molecular formula C26H27F3N4S and a molecular weight of 484.59 g/mol. Its IUPAC name is 6-(2-cyclopropylphenyl)-N-[[6-(3-methylpiperidin-1-yl)-2-pyridinyl]sulfanyl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-(2-cyclopropylphenyl)-N-[[6-(3-methylpiperidin-1-yl)-2-pyridinyl]sulfanyl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 166716770 |
| Molecular Formula | C26H27F3N4S |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 6-(2-cyclopropylphenyl)-N-[[6-(3-methylpiperidin-1-yl)-2-pyridinyl]sulfanyl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC1CCCN(c2cccc(SNc3ccc(C(F)(F)F)c(-c4ccccc4C4CC4)n3)n2)C1 |
| InChI | InChI=1S/C26H27F3N4S/c1-17-6-5-15-33(16-17)23-9-4-10-24(31-23)34-32-22-14-13-21(26(27,28)29)25(30-22)20-8-3-2-7-19(20)18-11-12-18/h2-4,7-10,13-14,17-18H,5-6,11-12,15-16H2,1H3,(H,30,32) |
| InChIKey | VVCMXRSGLMMPFW-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|