C20H20N4S — CID 166716688
N-[(6-amino-2-pyridinyl)sulfanyl]-5-cyclopropyl-6-(2-methylphenyl)pyridin-2-amine (PubChem CID 166716688) has the molecular formula C20H20N4S and a molecular weight of 348.48 g/mol. Its IUPAC name is N-[(6-amino-2-pyridinyl)sulfanyl]-5-cyclopropyl-6-(2-methylphenyl)pyridin-2-amine.
| Compound Name | N-[(6-amino-2-pyridinyl)sulfanyl]-5-cyclopropyl-6-(2-methylphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 166716688 |
| Molecular Formula | C20H20N4S |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-[(6-amino-2-pyridinyl)sulfanyl]-5-cyclopropyl-6-(2-methylphenyl)pyridin-2-amine |
| SMILES | Cc1ccccc1-c1nc(NSc2cccc(N)n2)ccc1C1CC1 |
| InChI | InChI=1S/C20H20N4S/c1-13-5-2-3-6-15(13)20-16(14-9-10-14)11-12-18(23-20)24-25-19-8-4-7-17(21)22-19/h2-8,11-12,14H,9-10H2,1H3,(H2,21,22)(H,23,24) |
| InChIKey | UNHOVHGECOQWDB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|