C20H15FN4O6 — CID 134346935
10-[(3S)-3-aminopyrrolidin-1-yl]-11-fluoro-5-nitro-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9(17),10,12,15-heptaene-15-carboxylic acid (PubChem CID 134346935) has the molecular formula C20H15FN4O6 and a molecular weight of 426.36 g/mol. Its IUPAC name is 10-[(3S)-3-aminopyrrolidin-1-yl]-11-fluoro-5-nitro-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9(17),10,12,15-heptaene-15-carboxylic acid.
| Compound Name | 10-[(3S)-3-aminopyrrolidin-1-yl]-11-fluoro-5-nitro-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9(17),10,12,15-heptaene-15-carboxylic acid |
|---|---|
| PubChem CID | 134346935 |
| Molecular Formula | C20H15FN4O6 |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 10-[(3S)-3-aminopyrrolidin-1-yl]-11-fluoro-5-nitro-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9(17),10,12,15-heptaene-15-carboxylic acid |
| SMILES | N[C@H]1CCN(c2c(F)cc3c(=O)c(C(=O)O)cn4c3c2Oc2cc([N+](=O)[O-])ccc2-4)C1 |
| InChI | InChI=1S/C20H15FN4O6/c21-13-6-11-16-19(17(13)23-4-3-9(22)7-23)31-15-5-10(25(29)30)1-2-14(15)24(16)8-12(18(11)26)20(27)28/h1-2,5-6,8-9H,3-4,7,22H2,(H,27,28)/t9-/m0/s1 |
| InChIKey | MDXFAQWIWGBZRL-VIFPVBQESA-N |
| XLogP | 2.38 |
| TPSA | 140.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|