C16H29NO6 — CID 13434695
(2S)-1-[(2S,5S)-2,5-bis(methoxymethoxymethyl)pyrrolidin-1-yl]-2-methylpentane-1,3-dione (PubChem CID 13434695) has the molecular formula C16H29NO6 and a molecular weight of 331.41 g/mol. Its IUPAC name is (2S)-1-[(2S,5S)-2,5-bis(methoxymethoxymethyl)pyrrolidin-1-yl]-2-methylpentane-1,3-dione.
| Compound Name | (2S)-1-[(2S,5S)-2,5-bis(methoxymethoxymethyl)pyrrolidin-1-yl]-2-methylpentane-1,3-dione |
|---|---|
| PubChem CID | 13434695 |
| Molecular Formula | C16H29NO6 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | (2S)-1-[(2S,5S)-2,5-bis(methoxymethoxymethyl)pyrrolidin-1-yl]-2-methylpentane-1,3-dione |
| SMILES | CCC(=O)[C@H](C)C(=O)N1[C@H](COCOC)CC[C@H]1COCOC |
| InChI | InChI=1S/C16H29NO6/c1-5-15(18)12(2)16(19)17-13(8-22-10-20-3)6-7-14(17)9-23-11-21-4/h12-14H,5-11H2,1-4H3/t12-,13-,14-/m0/s1 |
| InChIKey | WOPFFCZSMJZCLZ-IHRRRGAJSA-N |
| XLogP | 1.20 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|