C23H43NO6 — CID 134905469
(2S)-1-[(2S,5S)-2,5-bis(methoxymethoxymethyl)pyrrolidin-1-yl]-2-methyldodecane-1,3-dione (PubChem CID 134905469) has the molecular formula C23H43NO6 and a molecular weight of 429.60 g/mol. Its IUPAC name is (2S)-1-[(2S,5S)-2,5-bis(methoxymethoxymethyl)pyrrolidin-1-yl]-2-methyldodecane-1,3-dione.
| Compound Name | (2S)-1-[(2S,5S)-2,5-bis(methoxymethoxymethyl)pyrrolidin-1-yl]-2-methyldodecane-1,3-dione |
|---|---|
| PubChem CID | 134905469 |
| Molecular Formula | C23H43NO6 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.31 |
| IUPAC Name | (2S)-1-[(2S,5S)-2,5-bis(methoxymethoxymethyl)pyrrolidin-1-yl]-2-methyldodecane-1,3-dione |
| SMILES | CCCCCCCCCC(=O)[C@H](C)C(=O)N1[C@H](COCOC)CC[C@H]1COCOC |
| InChI | InChI=1S/C23H43NO6/c1-5-6-7-8-9-10-11-12-22(25)19(2)23(26)24-20(15-29-17-27-3)13-14-21(24)16-30-18-28-4/h19-21H,5-18H2,1-4H3/t19-,20-,21-/m0/s1 |
| InChIKey | XSCDVBBJNMWYMD-ACRUOGEOSA-N |
| XLogP | 3.93 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|