C18H33NO6 — CID 13434701
(2S)-1-[(2S,5S)-2,5-bis(methoxymethoxymethyl)pyrrolidin-1-yl]-2,4,4-trimethylpentane-1,3-dione (PubChem CID 13434701) has the molecular formula C18H33NO6 and a molecular weight of 359.46 g/mol. Its IUPAC name is (2S)-1-[(2S,5S)-2,5-bis(methoxymethoxymethyl)pyrrolidin-1-yl]-2,4,4-trimethylpentane-1,3-dione.
| Compound Name | (2S)-1-[(2S,5S)-2,5-bis(methoxymethoxymethyl)pyrrolidin-1-yl]-2,4,4-trimethylpentane-1,3-dione |
|---|---|
| PubChem CID | 13434701 |
| Molecular Formula | C18H33NO6 |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | (2S)-1-[(2S,5S)-2,5-bis(methoxymethoxymethyl)pyrrolidin-1-yl]-2,4,4-trimethylpentane-1,3-dione |
| SMILES | COCOC[C@@H]1CC[C@@H](COCOC)N1C(=O)[C@@H](C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C18H33NO6/c1-13(16(20)18(2,3)4)17(21)19-14(9-24-11-22-5)7-8-15(19)10-25-12-23-6/h13-15H,7-12H2,1-6H3/t13-,14-,15-/m0/s1 |
| InChIKey | WGLFRSHQSJVPOM-KKUMJFAQSA-N |
| XLogP | 1.84 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|