C11H19F3N2O3 — CID 134349474
3-[formyl(2,2,2-trifluoroethyl)amino]-2-hydroxy-N-(2-methylpropyl)butanamide (PubChem CID 134349474) has the molecular formula C11H19F3N2O3 and a molecular weight of 284.28 g/mol. Its IUPAC name is 3-[formyl(2,2,2-trifluoroethyl)amino]-2-hydroxy-N-(2-methylpropyl)butanamide.
| Compound Name | 3-[formyl(2,2,2-trifluoroethyl)amino]-2-hydroxy-N-(2-methylpropyl)butanamide |
|---|---|
| PubChem CID | 134349474 |
| Molecular Formula | C11H19F3N2O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3-[formyl(2,2,2-trifluoroethyl)amino]-2-hydroxy-N-(2-methylpropyl)butanamide |
| SMILES | CC(C)CNC(=O)C(O)C(C)N(C=O)CC(F)(F)F |
| InChI | InChI=1S/C11H19F3N2O3/c1-7(2)4-15-10(19)9(18)8(3)16(6-17)5-11(12,13)14/h6-9,18H,4-5H2,1-3H3,(H,15,19) |
| InChIKey | VBHGXMVCURDXLV-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|