C16H20N2O3 — CID 134349743
N-(cyclopropylmethyl)-3-(N-formyl-3-methylanilino)-2-oxobutanamide (PubChem CID 134349743) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-3-(N-formyl-3-methylanilino)-2-oxobutanamide.
| Compound Name | N-(cyclopropylmethyl)-3-(N-formyl-3-methylanilino)-2-oxobutanamide |
|---|---|
| PubChem CID | 134349743 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N-(cyclopropylmethyl)-3-(N-formyl-3-methylanilino)-2-oxobutanamide |
| SMILES | Cc1cccc(N(C=O)C(C)C(=O)C(=O)NCC2CC2)c1 |
| InChI | InChI=1S/C16H20N2O3/c1-11-4-3-5-14(8-11)18(10-19)12(2)15(20)16(21)17-9-13-6-7-13/h3-5,8,10,12-13H,6-7,9H2,1-2H3,(H,17,21) |
| InChIKey | LMHRBXXHPANFGR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|