C17H26F3N3O5 — CID 175818543
N-(cyclopropylmethyl)-3-[formyl(piperidin-4-ylmethyl)amino]-2-oxobutanamide;2,2,2-trifluoroacetic acid (PubChem CID 175818543) has the molecular formula C17H26F3N3O5 and a molecular weight of 409.41 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-3-[formyl(piperidin-4-ylmethyl)amino]-2-oxobutanamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(cyclopropylmethyl)-3-[formyl(piperidin-4-ylmethyl)amino]-2-oxobutanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175818543 |
| Molecular Formula | C17H26F3N3O5 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | N-(cyclopropylmethyl)-3-[formyl(piperidin-4-ylmethyl)amino]-2-oxobutanamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C(=O)C(=O)NCC1CC1)N(C=O)CC1CCNCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H25N3O3.C2HF3O2/c1-11(14(20)15(21)17-8-12-2-3-12)18(10-19)9-13-4-6-16-7-5-13;3-2(4,5)1(6)7/h10-13,16H,2-9H2,1H3,(H,17,21);(H,6,7) |
| InChIKey | PUYZLCMTADUJEO-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|