C9H16N2 — CID 134350120
N'-[(Z)-but-2-enyl]-N-but-3-en-2-ylmethanimidamide (PubChem CID 134350120) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is N'-[(Z)-but-2-enyl]-N-but-3-en-2-ylmethanimidamide.
| Compound Name | N'-[(Z)-but-2-enyl]-N-but-3-en-2-ylmethanimidamide |
|---|---|
| PubChem CID | 134350120 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | N'-[(Z)-but-2-enyl]-N-but-3-en-2-ylmethanimidamide |
| SMILES | C=CC(C)N/C=N/C/C=C\C |
| InChI | InChI=1S/C9H16N2/c1-4-6-7-10-8-11-9(3)5-2/h4-6,8-9H,2,7H2,1,3H3,(H,10,11)/b6-4- |
| InChIKey | GXJIZNNTRKIJLB-XQRVVYSFSA-N |
| XLogP | 1.75 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|