About N-(3-aminopropyl)-N-but-3-en-2-yl-N'-prop-2-enylmethanimidamide
N-(3-aminopropyl)-N-but-3-en-2-yl-N'-prop-2-enylmethanimidamide (PubChem CID 143086362) has the molecular formula C11H21N3
and a molecular weight of 195.31 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-but-3-en-2-yl-N'-prop-2-enylmethanimidamide.
Molecular Properties
| Compound Name | N-(3-aminopropyl)-N-but-3-en-2-yl-N'-prop-2-enylmethanimidamide |
| PubChem CID | 143086362 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | N-(3-aminopropyl)-N-but-3-en-2-yl-N'-prop-2-enylmethanimidamide |
| SMILES | C=CC/N=C/N(CCCN)C(C)C=C |
| InChI | InChI=1S/C11H21N3/c1-4-8-13-10-14(9-6-7-12)11(3)5-2/h4-5,10-11H,1-2,6-9,12H2,3H3/b13-10+ |
| InChIKey | VYONGMCLQYHZQU-JLHYYAGUSA-N |
| XLogP | 1.43 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(3-aminopropyl)-N-but-3-en-2-yl-N'-prop-2-enylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-aminopropyl)-N-but-3-en-2-yl-N'-prop-2-enylmethanimidamide?
The IUPAC name of N-(3-aminopropyl)-N-but-3-en-2-yl-N'-prop-2-enylmethanimidamide (CID 143086362) is N-(3-aminopropyl)-N-but-3-en-2-yl-N'-prop-2-enylmethanimidamide.
What is the SMILES notation for N-(3-aminopropyl)-N-but-3-en-2-yl-N'-prop-2-enylmethanimidamide?
The canonical SMILES for N-(3-aminopropyl)-N-but-3-en-2-yl-N'-prop-2-enylmethanimidamide is C=CC/N=C/N(CCCN)C(C)C=C.
What is the InChIKey of N-(3-aminopropyl)-N-but-3-en-2-yl-N'-prop-2-enylmethanimidamide?
The InChIKey is VYONGMCLQYHZQU-JLHYYAGUSA-N. The full InChI is InChI=1S/C11H21N3/c1-4-8-13-10-14(9-6-7-12)11(3)5-2/h4-5,10-11H,1-2,6-9,12H2,3H3/b13-10+.
What are the key properties of N-(3-aminopropyl)-N-but-3-en-2-yl-N'-prop-2-enylmethanimidamide?
N-(3-aminopropyl)-N-but-3-en-2-yl-N'-prop-2-enylmethanimidamide has a molecular weight of 195.31 g/mol, XLogP of 1.43, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-aminopropyl)-N-but-3-en-2-yl-N'-prop-2-enylmethanimidamide is sourced from PubChem (CID 143086362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).