C18H28N2O4S — CID 134350767
2-[[4-[(E)-3,6-dimethyloct-4-en-3-yl]pyridine-2-carbonyl]amino]ethanesulfonic acid (PubChem CID 134350767) has the molecular formula C18H28N2O4S and a molecular weight of 368.50 g/mol. Its IUPAC name is 2-[[4-[(E)-3,6-dimethyloct-4-en-3-yl]pyridine-2-carbonyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[(E)-3,6-dimethyloct-4-en-3-yl]pyridine-2-carbonyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 134350767 |
| Molecular Formula | C18H28N2O4S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 2-[[4-[(E)-3,6-dimethyloct-4-en-3-yl]pyridine-2-carbonyl]amino]ethanesulfonic acid |
| SMILES | CCC(C)/C=C/C(C)(CC)c1ccnc(C(=O)NCCS(=O)(=O)O)c1 |
| InChI | InChI=1S/C18H28N2O4S/c1-5-14(3)7-9-18(4,6-2)15-8-10-19-16(13-15)17(21)20-11-12-25(22,23)24/h7-10,13-14H,5-6,11-12H2,1-4H3,(H,20,21)(H,22,23,24)/b9-7+ |
| InChIKey | QNIGKLLPZKDEDK-VQHVLOKHSA-N |
| XLogP | 2.97 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|