C21H34N2O7S2 — CID 147717665
2-[2-sulfoethyl-[4-[(E)-3,6,6-trimethyloct-4-en-3-yl]pyridine-2-carbonyl]amino]ethanesulfonic acid (PubChem CID 147717665) has the molecular formula C21H34N2O7S2 and a molecular weight of 490.64 g/mol. Its IUPAC name is 2-[2-sulfoethyl-[4-[(E)-3,6,6-trimethyloct-4-en-3-yl]pyridine-2-carbonyl]amino]ethanesulfonic acid.
| Compound Name | 2-[2-sulfoethyl-[4-[(E)-3,6,6-trimethyloct-4-en-3-yl]pyridine-2-carbonyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 147717665 |
| Molecular Formula | C21H34N2O7S2 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 2-[2-sulfoethyl-[4-[(E)-3,6,6-trimethyloct-4-en-3-yl]pyridine-2-carbonyl]amino]ethanesulfonic acid |
| SMILES | CCC(C)(C)/C=C/C(C)(CC)c1ccnc(C(=O)N(CCS(=O)(=O)O)CCS(=O)(=O)O)c1 |
| InChI | InChI=1S/C21H34N2O7S2/c1-6-20(3,4)9-10-21(5,7-2)17-8-11-22-18(16-17)19(24)23(12-14-31(25,26)27)13-15-32(28,29)30/h8-11,16H,6-7,12-15H2,1-5H3,(H,25,26,27)(H,28,29,30)/b10-9+ |
| InChIKey | GVYMVZUUHLLHFV-MDZDMXLPSA-N |
| XLogP | 2.96 |
| TPSA | 141.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|