C27H20ClF3N2O4 — CID 134354498
2-chloro-4-[(4-cyclopropylisoquinolin-3-yl)-[[4-(trifluoromethoxy)phenyl]methyl]amino]oxybenzoic acid (PubChem CID 134354498) has the molecular formula C27H20ClF3N2O4 and a molecular weight of 528.91 g/mol. Its IUPAC name is 2-chloro-4-[(4-cyclopropylisoquinolin-3-yl)-[[4-(trifluoromethoxy)phenyl]methyl]amino]oxybenzoic acid.
| Compound Name | 2-chloro-4-[(4-cyclopropylisoquinolin-3-yl)-[[4-(trifluoromethoxy)phenyl]methyl]amino]oxybenzoic acid |
|---|---|
| PubChem CID | 134354498 |
| Molecular Formula | C27H20ClF3N2O4 |
| Molecular Weight | 528.91 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 2-chloro-4-[(4-cyclopropylisoquinolin-3-yl)-[[4-(trifluoromethoxy)phenyl]methyl]amino]oxybenzoic acid |
| SMILES | O=C(O)c1ccc(ON(Cc2ccc(OC(F)(F)F)cc2)c2ncc3ccccc3c2C2CC2)cc1Cl |
| InChI | InChI=1S/C27H20ClF3N2O4/c28-23-13-20(11-12-22(23)26(34)35)37-33(15-16-5-9-19(10-6-16)36-27(29,30)31)25-24(17-7-8-17)21-4-2-1-3-18(21)14-32-25/h1-6,9-14,17H,7-8,15H2,(H,34,35) |
| InChIKey | WDDJQACNUVMHAY-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.91 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|