C13H15FN4O2S — CID 134354924
1-[[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(2-methoxyethyl)thiourea (PubChem CID 134354924) has the molecular formula C13H15FN4O2S and a molecular weight of 310.35 g/mol. Its IUPAC name is 1-[[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 134354924 |
| Molecular Formula | C13H15FN4O2S |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 1-[[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)NCc1nc(-c2cccc(F)c2)no1 |
| InChI | InChI=1S/C13H15FN4O2S/c1-19-6-5-15-13(21)16-8-11-17-12(18-20-11)9-3-2-4-10(14)7-9/h2-4,7H,5-6,8H2,1H3,(H2,15,16,21) |
| InChIKey | JHVBOBGTDPPVCS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 72.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|