C22H24FN5O3 — CID 134356987
1-[1-[[5-(2-fluoro-3-pyridinyl)-2-pyridinyl]amino]-1-oxopropan-2-yl]-5-formyl-N,N-dimethyl-3,4-dihydro-2H-pyridine-6-carboxamide (PubChem CID 134356987) has the molecular formula C22H24FN5O3 and a molecular weight of 425.46 g/mol. Its IUPAC name is 1-[1-[[5-(2-fluoro-3-pyridinyl)-2-pyridinyl]amino]-1-oxopropan-2-yl]-5-formyl-N,N-dimethyl-3,4-dihydro-2H-pyridine-6-carboxamide.
| Compound Name | 1-[1-[[5-(2-fluoro-3-pyridinyl)-2-pyridinyl]amino]-1-oxopropan-2-yl]-5-formyl-N,N-dimethyl-3,4-dihydro-2H-pyridine-6-carboxamide |
|---|---|
| PubChem CID | 134356987 |
| Molecular Formula | C22H24FN5O3 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 1-[1-[[5-(2-fluoro-3-pyridinyl)-2-pyridinyl]amino]-1-oxopropan-2-yl]-5-formyl-N,N-dimethyl-3,4-dihydro-2H-pyridine-6-carboxamide |
| SMILES | CC(C(=O)Nc1ccc(-c2cccnc2F)cn1)N1CCCC(C=O)=C1C(=O)N(C)C |
| InChI | InChI=1S/C22H24FN5O3/c1-14(28-11-5-6-16(13-29)19(28)22(31)27(2)3)21(30)26-18-9-8-15(12-25-18)17-7-4-10-24-20(17)23/h4,7-10,12-14H,5-6,11H2,1-3H3,(H,25,26,30) |
| InChIKey | NCKOGIXQWHHZAX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|