C18H18N4O3 — CID 96510144
(2S)-N-[5-(dimethylamino)-2-pyridinyl]-2-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 96510144) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is (2S)-N-[5-(dimethylamino)-2-pyridinyl]-2-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | (2S)-N-[5-(dimethylamino)-2-pyridinyl]-2-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 96510144 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (2S)-N-[5-(dimethylamino)-2-pyridinyl]-2-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(N(C)C)cn1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H18N4O3/c1-11(16(23)20-15-9-8-12(10-19-15)21(2)3)22-17(24)13-6-4-5-7-14(13)18(22)25/h4-11H,1-3H3,(H,19,20,23)/t11-/m0/s1 |
| InChIKey | DYZCOYGUUORPIK-NSHDSACASA-N |
| XLogP | 1.77 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|