C11H20Cl2N4O — CID 119863152
2-amino-N-[5-(dimethylamino)-2-pyridinyl]-2-methylpropanamide;dihydrochloride (PubChem CID 119863152) has the molecular formula C11H20Cl2N4O and a molecular weight of 295.21 g/mol. Its IUPAC name is 2-amino-N-[5-(dimethylamino)-2-pyridinyl]-2-methylpropanamide;dihydrochloride.
| Compound Name | 2-amino-N-[5-(dimethylamino)-2-pyridinyl]-2-methylpropanamide;dihydrochloride |
|---|---|
| PubChem CID | 119863152 |
| Molecular Formula | C11H20Cl2N4O |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-amino-N-[5-(dimethylamino)-2-pyridinyl]-2-methylpropanamide;dihydrochloride |
| SMILES | CN(C)c1ccc(NC(=O)C(C)(C)N)nc1.Cl.Cl |
| InChI | InChI=1S/C11H18N4O.2ClH/c1-11(2,12)10(16)14-9-6-5-8(7-13-9)15(3)4;;/h5-7H,12H2,1-4H3,(H,13,14,16);2*1H |
| InChIKey | PDHJSJCEYOOHFQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |