About 5-N,5-N-dimethyl-2-N-(2-methylpropyl)pyridine-2,5-diamine
5-N,5-N-dimethyl-2-N-(2-methylpropyl)pyridine-2,5-diamine (PubChem CID 115876832) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is 5-N,5-N-dimethyl-2-N-(2-methylpropyl)pyridine-2,5-diamine.
Molecular Properties
| Compound Name | 5-N,5-N-dimethyl-2-N-(2-methylpropyl)pyridine-2,5-diamine |
| PubChem CID | 115876832 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 5-N,5-N-dimethyl-2-N-(2-methylpropyl)pyridine-2,5-diamine |
| SMILES | CC(C)CNc1ccc(N(C)C)cn1 |
| InChI | InChI=1S/C11H19N3/c1-9(2)7-12-11-6-5-10(8-13-11)14(3)4/h5-6,8-9H,7H2,1-4H3,(H,12,13) |
| InChIKey | JNOURIVMMNPFFK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-N,5-N-dimethyl-2-N-(2-methylpropyl)pyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N,5-N-dimethyl-2-N-(2-methylpropyl)pyridine-2,5-diamine?
The IUPAC name of 5-N,5-N-dimethyl-2-N-(2-methylpropyl)pyridine-2,5-diamine (CID 115876832) is 5-N,5-N-dimethyl-2-N-(2-methylpropyl)pyridine-2,5-diamine.
What is the SMILES notation for 5-N,5-N-dimethyl-2-N-(2-methylpropyl)pyridine-2,5-diamine?
The canonical SMILES for 5-N,5-N-dimethyl-2-N-(2-methylpropyl)pyridine-2,5-diamine is CC(C)CNc1ccc(N(C)C)cn1.
What is the InChIKey of 5-N,5-N-dimethyl-2-N-(2-methylpropyl)pyridine-2,5-diamine?
The InChIKey is JNOURIVMMNPFFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3/c1-9(2)7-12-11-6-5-10(8-13-11)14(3)4/h5-6,8-9H,7H2,1-4H3,(H,12,13).
What are the key properties of 5-N,5-N-dimethyl-2-N-(2-methylpropyl)pyridine-2,5-diamine?
5-N,5-N-dimethyl-2-N-(2-methylpropyl)pyridine-2,5-diamine has a molecular weight of 193.29 g/mol, XLogP of 2.22, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N,5-N-dimethyl-2-N-(2-methylpropyl)pyridine-2,5-diamine is sourced from PubChem (CID 115876832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).