C12H15Cl2N3O — CID 94218590
(1S)-2,2-dichloro-N-[5-(dimethylamino)-2-pyridinyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 94218590) has the molecular formula C12H15Cl2N3O and a molecular weight of 288.18 g/mol. Its IUPAC name is (1S)-2,2-dichloro-N-[5-(dimethylamino)-2-pyridinyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | (1S)-2,2-dichloro-N-[5-(dimethylamino)-2-pyridinyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 94218590 |
| Molecular Formula | C12H15Cl2N3O |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | (1S)-2,2-dichloro-N-[5-(dimethylamino)-2-pyridinyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)[C@]2(C)CC2(Cl)Cl)nc1 |
| InChI | InChI=1S/C12H15Cl2N3O/c1-11(7-12(11,13)14)10(18)16-9-5-4-8(6-15-9)17(2)3/h4-6H,7H2,1-3H3,(H,15,16,18)/t11-/m0/s1 |
| InChIKey | USKLYPRMOMSRKZ-NSHDSACASA-N |
| XLogP | 2.67 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|