C17H20N4OS — CID 97251269
(2R)-N-(5-pyridin-2-yl-2-pyridinyl)-2-thiomorpholin-4-ylpropanamide (PubChem CID 97251269) has the molecular formula C17H20N4OS and a molecular weight of 328.44 g/mol. Its IUPAC name is (2R)-N-(5-pyridin-2-yl-2-pyridinyl)-2-thiomorpholin-4-ylpropanamide.
| Compound Name | (2R)-N-(5-pyridin-2-yl-2-pyridinyl)-2-thiomorpholin-4-ylpropanamide |
|---|---|
| PubChem CID | 97251269 |
| Molecular Formula | C17H20N4OS |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (2R)-N-(5-pyridin-2-yl-2-pyridinyl)-2-thiomorpholin-4-ylpropanamide |
| SMILES | C[C@H](C(=O)Nc1ccc(-c2ccccn2)cn1)N1CCSCC1 |
| InChI | InChI=1S/C17H20N4OS/c1-13(21-8-10-23-11-9-21)17(22)20-16-6-5-14(12-19-16)15-4-2-3-7-18-15/h2-7,12-13H,8-11H2,1H3,(H,19,20,22)/t13-/m1/s1 |
| InChIKey | PORRKAAERIKXPI-CYBMUJFWSA-N |
| XLogP | 2.52 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |