C16H19N3O2S — CID 75388529
N-[3-(1,3-oxazol-2-yl)phenyl]-2-thiomorpholin-4-ylpropanamide (PubChem CID 75388529) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-[3-(1,3-oxazol-2-yl)phenyl]-2-thiomorpholin-4-ylpropanamide.
| Compound Name | N-[3-(1,3-oxazol-2-yl)phenyl]-2-thiomorpholin-4-ylpropanamide |
|---|---|
| PubChem CID | 75388529 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-[3-(1,3-oxazol-2-yl)phenyl]-2-thiomorpholin-4-ylpropanamide |
| SMILES | CC(C(=O)Nc1cccc(-c2ncco2)c1)N1CCSCC1 |
| InChI | InChI=1S/C16H19N3O2S/c1-12(19-6-9-22-10-7-19)15(20)18-14-4-2-3-13(11-14)16-17-5-8-21-16/h2-5,8,11-12H,6-7,9-10H2,1H3,(H,18,20) |
| InChIKey | DAWYFLKJURMXIB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |