C15H19N3O2S — CID 122159499
1-(3-ethylsulfanylpropyl)-3-[3-(1,3-oxazol-2-yl)phenyl]urea (PubChem CID 122159499) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 1-(3-ethylsulfanylpropyl)-3-[3-(1,3-oxazol-2-yl)phenyl]urea.
| Compound Name | 1-(3-ethylsulfanylpropyl)-3-[3-(1,3-oxazol-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 122159499 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 1-(3-ethylsulfanylpropyl)-3-[3-(1,3-oxazol-2-yl)phenyl]urea |
| SMILES | CCSCCCNC(=O)Nc1cccc(-c2ncco2)c1 |
| InChI | InChI=1S/C15H19N3O2S/c1-2-21-10-4-7-17-15(19)18-13-6-3-5-12(11-13)14-16-8-9-20-14/h3,5-6,8-9,11H,2,4,7,10H2,1H3,(H2,17,18,19) |
| InChIKey | HCAKFWRYUVPCNP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|