C17H21N3O3 — CID 97326645
N'-methyl-N'-[(2S)-2-methylbutyl]-N-[3-(1,3-oxazol-2-yl)phenyl]oxamide (PubChem CID 97326645) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N'-methyl-N'-[(2S)-2-methylbutyl]-N-[3-(1,3-oxazol-2-yl)phenyl]oxamide.
| Compound Name | N'-methyl-N'-[(2S)-2-methylbutyl]-N-[3-(1,3-oxazol-2-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 97326645 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N'-methyl-N'-[(2S)-2-methylbutyl]-N-[3-(1,3-oxazol-2-yl)phenyl]oxamide |
| SMILES | CC[C@H](C)CN(C)C(=O)C(=O)Nc1cccc(-c2ncco2)c1 |
| InChI | InChI=1S/C17H21N3O3/c1-4-12(2)11-20(3)17(22)15(21)19-14-7-5-6-13(10-14)16-18-8-9-23-16/h5-10,12H,4,11H2,1-3H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | QYIIVTHYUKUZIT-LBPRGKRZSA-N |
| XLogP | 2.78 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|