C23H21Cl2N3OS — CID 134357424
1-[6-[(2-chloro-6-methoxy-3-pyridinyl)methyl]-1-(3-chlorophenyl)sulfanylindol-3-yl]-N-methylmethanamine (PubChem CID 134357424) has the molecular formula C23H21Cl2N3OS and a molecular weight of 458.41 g/mol. Its IUPAC name is 1-[6-[(2-chloro-6-methoxy-3-pyridinyl)methyl]-1-(3-chlorophenyl)sulfanylindol-3-yl]-N-methylmethanamine.
| Compound Name | 1-[6-[(2-chloro-6-methoxy-3-pyridinyl)methyl]-1-(3-chlorophenyl)sulfanylindol-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 134357424 |
| Molecular Formula | C23H21Cl2N3OS |
| Molecular Weight | 458.41 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 1-[6-[(2-chloro-6-methoxy-3-pyridinyl)methyl]-1-(3-chlorophenyl)sulfanylindol-3-yl]-N-methylmethanamine |
| SMILES | CNCc1cn(Sc2cccc(Cl)c2)c2cc(Cc3ccc(OC)nc3Cl)ccc12 |
| InChI | InChI=1S/C23H21Cl2N3OS/c1-26-13-17-14-28(30-19-5-3-4-18(24)12-19)21-11-15(6-8-20(17)21)10-16-7-9-22(29-2)27-23(16)25/h3-9,11-12,14,26H,10,13H2,1-2H3 |
| InChIKey | JPCLOCLYSKKFEN-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.41 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|