C21H18ClFN4S — CID 134357564
N-(2-chloro-4-fluorophenyl)-3-(methylaminomethyl)-1-pyridin-3-ylsulfanylindol-6-amine (PubChem CID 134357564) has the molecular formula C21H18ClFN4S and a molecular weight of 412.92 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-3-(methylaminomethyl)-1-pyridin-3-ylsulfanylindol-6-amine.
| Compound Name | N-(2-chloro-4-fluorophenyl)-3-(methylaminomethyl)-1-pyridin-3-ylsulfanylindol-6-amine |
|---|---|
| PubChem CID | 134357564 |
| Molecular Formula | C21H18ClFN4S |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-3-(methylaminomethyl)-1-pyridin-3-ylsulfanylindol-6-amine |
| SMILES | CNCc1cn(Sc2cccnc2)c2cc(Nc3ccc(F)cc3Cl)ccc12 |
| InChI | InChI=1S/C21H18ClFN4S/c1-24-11-14-13-27(28-17-3-2-8-25-12-17)21-10-16(5-6-18(14)21)26-20-7-4-15(23)9-19(20)22/h2-10,12-13,24,26H,11H2,1H3 |
| InChIKey | VIWGNICOPLXAFZ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |