C24H21N5OS — CID 118000947
N-[3-(methylaminomethyl)-1-pyridin-3-ylsulfinylindol-6-yl]quinolin-6-amine (PubChem CID 118000947) has the molecular formula C24H21N5OS and a molecular weight of 427.53 g/mol. Its IUPAC name is N-[3-(methylaminomethyl)-1-pyridin-3-ylsulfinylindol-6-yl]quinolin-6-amine.
| Compound Name | N-[3-(methylaminomethyl)-1-pyridin-3-ylsulfinylindol-6-yl]quinolin-6-amine |
|---|---|
| PubChem CID | 118000947 |
| Molecular Formula | C24H21N5OS |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | N-[3-(methylaminomethyl)-1-pyridin-3-ylsulfinylindol-6-yl]quinolin-6-amine |
| SMILES | CNCc1cn(S(=O)c2cccnc2)c2cc(Nc3ccc4ncccc4c3)ccc12 |
| InChI | InChI=1S/C24H21N5OS/c1-25-14-18-16-29(31(30)21-5-3-10-26-15-21)24-13-20(6-8-22(18)24)28-19-7-9-23-17(12-19)4-2-11-27-23/h2-13,15-16,25,28H,14H2,1H3 |
| InChIKey | PELDFXBUGOQORR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |