C20H17BrFN5OS — CID 134357258
N-(2-bromo-6-fluoro-3-pyridinyl)-3-(methylaminomethyl)-1-pyridin-3-ylsulfinylindol-6-amine (PubChem CID 134357258) has the molecular formula C20H17BrFN5OS and a molecular weight of 474.36 g/mol. Its IUPAC name is N-(2-bromo-6-fluoro-3-pyridinyl)-3-(methylaminomethyl)-1-pyridin-3-ylsulfinylindol-6-amine.
| Compound Name | N-(2-bromo-6-fluoro-3-pyridinyl)-3-(methylaminomethyl)-1-pyridin-3-ylsulfinylindol-6-amine |
|---|---|
| PubChem CID | 134357258 |
| Molecular Formula | C20H17BrFN5OS |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 473.03 |
| IUPAC Name | N-(2-bromo-6-fluoro-3-pyridinyl)-3-(methylaminomethyl)-1-pyridin-3-ylsulfinylindol-6-amine |
| SMILES | CNCc1cn(S(=O)c2cccnc2)c2cc(Nc3ccc(F)nc3Br)ccc12 |
| InChI | InChI=1S/C20H17BrFN5OS/c1-23-10-13-12-27(29(28)15-3-2-8-24-11-15)18-9-14(4-5-16(13)18)25-17-6-7-19(22)26-20(17)21/h2-9,11-12,23,25H,10H2,1H3 |
| InChIKey | UNVJSHPBYTWGFL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|