C21H20N6O4S2 — CID 134357895
N-[(Z)-3-amino-2-[amino(1,3-thiazol-2-yl)amino]prop-2-enyl]-4-methyl-6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 134357895) has the molecular formula C21H20N6O4S2 and a molecular weight of 484.56 g/mol. Its IUPAC name is N-[(Z)-3-amino-2-[amino(1,3-thiazol-2-yl)amino]prop-2-enyl]-4-methyl-6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-[(Z)-3-amino-2-[amino(1,3-thiazol-2-yl)amino]prop-2-enyl]-4-methyl-6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 134357895 |
| Molecular Formula | C21H20N6O4S2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | N-[(Z)-3-amino-2-[amino(1,3-thiazol-2-yl)amino]prop-2-enyl]-4-methyl-6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | Cc1c(C(=O)NC/C(=C/N)N(N)c2nccs2)ccc2c1NC(=O)c1ccccc1S2(=O)=O |
| InChI | InChI=1S/C21H20N6O4S2/c1-12-14(19(28)25-11-13(10-22)27(23)21-24-8-9-32-21)6-7-17-18(12)26-20(29)15-4-2-3-5-16(15)33(17,30)31/h2-10H,11,22-23H2,1H3,(H,25,28)(H,26,29)/b13-10- |
| InChIKey | QUYPWUPJQLUKRD-RAXLEYEMSA-N |
| XLogP | 1.76 |
| TPSA | 160.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|