C19H14N4O2S — CID 51128195
2-(2-cyanophenyl)-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]benzamide (PubChem CID 51128195) has the molecular formula C19H14N4O2S and a molecular weight of 362.41 g/mol. Its IUPAC name is 2-(2-cyanophenyl)-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]benzamide.
| Compound Name | 2-(2-cyanophenyl)-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 51128195 |
| Molecular Formula | C19H14N4O2S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 2-(2-cyanophenyl)-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]benzamide |
| SMILES | N#Cc1ccccc1-c1ccccc1C(=O)NCC(=O)Nc1nccs1 |
| InChI | InChI=1S/C19H14N4O2S/c20-11-13-5-1-2-6-14(13)15-7-3-4-8-16(15)18(25)22-12-17(24)23-19-21-9-10-26-19/h1-10H,12H2,(H,22,25)(H,21,23,24) |
| InChIKey | FAPRXFNPUCPGIN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |