C29H36F4 — CID 134358783
1-[2,3-difluoro-4-(4-hexylcyclohexyl)phenyl]-2,3-difluoro-4-[(Z)-pent-2-enyl]benzene (PubChem CID 134358783) has the molecular formula C29H36F4 and a molecular weight of 460.60 g/mol. Its IUPAC name is 1-[2,3-difluoro-4-(4-hexylcyclohexyl)phenyl]-2,3-difluoro-4-[(Z)-pent-2-enyl]benzene.
| Compound Name | 1-[2,3-difluoro-4-(4-hexylcyclohexyl)phenyl]-2,3-difluoro-4-[(Z)-pent-2-enyl]benzene |
|---|---|
| PubChem CID | 134358783 |
| Molecular Formula | C29H36F4 |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | 1-[2,3-difluoro-4-(4-hexylcyclohexyl)phenyl]-2,3-difluoro-4-[(Z)-pent-2-enyl]benzene |
| SMILES | CC/C=C\Cc1ccc(-c2ccc(C3CCC(CCCCCC)CC3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C29H36F4/c1-3-5-7-9-10-20-12-14-21(15-13-20)23-18-19-25(29(33)27(23)31)24-17-16-22(11-8-6-4-2)26(30)28(24)32/h6,8,16-21H,3-5,7,9-15H2,1-2H3/b8-6- |
| InChIKey | MEGLPVKNNFBLAD-VURMDHGXSA-N |
| XLogP | 9.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|