C22H18ClN5OS — CID 134359416
(NE)-N-[(Z)-1-[7-(4-chlorophenyl)-5,13-dimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]hex-4-en-1-yn-3-ylidene]hydroxylamine (PubChem CID 134359416) has the molecular formula C22H18ClN5OS and a molecular weight of 435.94 g/mol. Its IUPAC name is (NE)-N-[(Z)-1-[7-(4-chlorophenyl)-5,13-dimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]hex-4-en-1-yn-3-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(Z)-1-[7-(4-chlorophenyl)-5,13-dimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]hex-4-en-1-yn-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 134359416 |
| Molecular Formula | C22H18ClN5OS |
| Molecular Weight | 435.94 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | (NE)-N-[(Z)-1-[7-(4-chlorophenyl)-5,13-dimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]hex-4-en-1-yn-3-ylidene]hydroxylamine |
| SMILES | C/C=C\C(C#Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=NCc1nnc(C)n1-2)=N/O |
| InChI | InChI=1S/C22H18ClN5OS/c1-4-5-17(27-29)10-11-18-13(2)20-21(15-6-8-16(23)9-7-15)24-12-19-26-25-14(3)28(19)22(20)30-18/h4-9,29H,12H2,1-3H3/b5-4-,27-17+ |
| InChIKey | LEBRMHPJSZJHNQ-DHKXSPSESA-N |
| XLogP | 4.71 |
| TPSA | 75.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.94 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|