C23H15ClFN5S — CID 135299929
7-(4-chlorophenyl)-4-[2-(5-fluoro-2-pyridinyl)ethynyl]-5,13-dimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 135299929) has the molecular formula C23H15ClFN5S and a molecular weight of 447.93 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-4-[2-(5-fluoro-2-pyridinyl)ethynyl]-5,13-dimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | 7-(4-chlorophenyl)-4-[2-(5-fluoro-2-pyridinyl)ethynyl]-5,13-dimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 135299929 |
| Molecular Formula | C23H15ClFN5S |
| Molecular Weight | 447.93 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | 7-(4-chlorophenyl)-4-[2-(5-fluoro-2-pyridinyl)ethynyl]-5,13-dimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | Cc1c(C#Cc2ccc(F)cn2)sc2c1C(c1ccc(Cl)cc1)=NCc1nnc(C)n1-2 |
| InChI | InChI=1S/C23H15ClFN5S/c1-13-19(10-9-18-8-7-17(25)11-26-18)31-23-21(13)22(15-3-5-16(24)6-4-15)27-12-20-29-28-14(2)30(20)23/h3-8,11H,12H2,1-2H3 |
| InChIKey | KDGKXQNRHCBOCF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.93 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|