C21H19ClN4S — CID 152791875
(9S)-4-but-1-ynyl-7-(4-chlorophenyl)-5,9,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 152791875) has the molecular formula C21H19ClN4S and a molecular weight of 394.93 g/mol. Its IUPAC name is (9S)-4-but-1-ynyl-7-(4-chlorophenyl)-5,9,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | (9S)-4-but-1-ynyl-7-(4-chlorophenyl)-5,9,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 152791875 |
| Molecular Formula | C21H19ClN4S |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | (9S)-4-but-1-ynyl-7-(4-chlorophenyl)-5,9,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | CCC#Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](C)c1nnc(C)n1-2 |
| InChI | InChI=1S/C21H19ClN4S/c1-5-6-7-17-12(2)18-19(15-8-10-16(22)11-9-15)23-13(3)20-25-24-14(4)26(20)21(18)27-17/h8-11,13H,5H2,1-4H3/t13-/m0/s1 |
| InChIKey | SIAXOUHUJPVGJH-ZDUSSCGKSA-N |
| XLogP | 5.27 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|