C22H21ClN4OS — CID 135290597
5-[(9S)-7-(4-chlorophenyl)-5,9,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]pent-4-yn-1-ol (PubChem CID 135290597) has the molecular formula C22H21ClN4OS and a molecular weight of 424.96 g/mol. Its IUPAC name is 5-[(9S)-7-(4-chlorophenyl)-5,9,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]pent-4-yn-1-ol.
| Compound Name | 5-[(9S)-7-(4-chlorophenyl)-5,9,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]pent-4-yn-1-ol |
|---|---|
| PubChem CID | 135290597 |
| Molecular Formula | C22H21ClN4OS |
| Molecular Weight | 424.96 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 5-[(9S)-7-(4-chlorophenyl)-5,9,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]pent-4-yn-1-ol |
| SMILES | Cc1c(C#CCCCO)sc2c1C(c1ccc(Cl)cc1)=N[C@@H](C)c1nnc(C)n1-2 |
| InChI | InChI=1S/C22H21ClN4OS/c1-13-18(7-5-4-6-12-28)29-22-19(13)20(16-8-10-17(23)11-9-16)24-14(2)21-26-25-15(3)27(21)22/h8-11,14,28H,4,6,12H2,1-3H3/t14-/m0/s1 |
| InChIKey | ZECXVAZMFCEGPO-AWEZNQCLSA-N |
| XLogP | 4.64 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.96 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|