C32H32ClN7OS — CID 172548764
N-[3-[5-(6-aminohex-1-ynyl)-1H-pyrrol-2-yl]prop-2-ynyl]-2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetamide (PubChem CID 172548764) has the molecular formula C32H32ClN7OS and a molecular weight of 598.18 g/mol. Its IUPAC name is N-[3-[5-(6-aminohex-1-ynyl)-1H-pyrrol-2-yl]prop-2-ynyl]-2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetamide.
| Compound Name | N-[3-[5-(6-aminohex-1-ynyl)-1H-pyrrol-2-yl]prop-2-ynyl]-2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetamide |
|---|---|
| PubChem CID | 172548764 |
| Molecular Formula | C32H32ClN7OS |
| Molecular Weight | 598.18 g/mol |
| Exact Mass | 597.21 |
| IUPAC Name | N-[3-[5-(6-aminohex-1-ynyl)-1H-pyrrol-2-yl]prop-2-ynyl]-2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetamide |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)NCC#Cc1ccc(C#CCCCCN)[nH]1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C32H32ClN7OS/c1-20-21(2)42-32-29(20)30(23-11-13-24(33)14-12-23)37-27(31-39-38-22(3)40(31)32)19-28(41)35-18-8-10-26-16-15-25(36-26)9-6-4-5-7-17-34/h11-16,27,36H,4-5,7,17-19,34H2,1-3H3,(H,35,41)/t27-/m0/s1 |
| InChIKey | QCJJPDBJBDHNOG-MHZLTWQESA-N |
| XLogP | 5.17 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.18 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|